Témbongkeun sumber pikeun Métionin

{{Short description|Asam amino anu ngandung walirang}}
{{chembox
| Name = Métionin
| ImageFile = Methionin - Methionine.svg
| ImageName = Wangun kimia métionin
| ImageCaption = [[Rumus rangka]] bentuk kanonik métionin
| ImageFileL2 = Methionine-from-xtal-3D-bs-17.png
| ImageSizeL2 = 120px
| ImageCaptionL2 = [[Modél bal-jeung-tongkat]]
| ImageFileR2 = L-methionine-from-xtal-Mercury-3D-sf.png
| ImageSizeR2 = 120px
| ImageCaptionR2 = [[modél ngeusi-rohang]]
| IUPACName = Métionin
| OtherNames = Asam 2-amino-4-(métiltio)butanoat
|Section1={{Chembox Identifiers
| index1_label = D/L
| index2_label = D
| index_label = L <!-- needs to be L (natural isomer) so drugbank etc. take correct index_label -->
| Abbreviations = Met, M
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1 = 73JWT2K6T3
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = AE28F7PNPL
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = 868496F25R
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 42336
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00073
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FFEARJCKVFRZRR-BYPYZUCNSA-N
| InChIKey1 = FFEARJCKVFRZRR-UHFFFAOYSA-N
| InChIKey2 = FFEARJCKVFRZRR-SCSAIBSYSA-N
| CASNo1 = 59-51-8
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo = 63-68-3
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo2 = 348-67-4
| CASNo2_Ref = {{cascite|correct|CAS}}
| EC_number = 200-432-1
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 853
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5907
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID2 =76512
| PubChem = 6137
| PubChem1 = 876
| PubChem2 = 84815
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16643
| ChEBI1_Ref = {{ebicite|correct|EBI}}
| ChEBI1 = 16811
| ChEBI2_Ref = {{ebicite|correct|EBI}}
| ChEBI2 = 16867
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00134
| SMILES = CSCC[C@H](N)C(=O)O
| SMILES3 = CSCC[C@H]([NH3+])C(=O)[O-]
| SMILES3_Comment = L [[Zwitterion]]
}}
|Section2={{Chembox Properties
| Properties_ref = <ref>{{RubberBible62nd|page=C-374}}.</ref>
| C=5 | H=11 | N=1 | O=2 | S=1
| Appearance = White crystalline powder
| Density = 1.340 g/cm<sup>3</sup>
| MeltingPtC = 281
| MeltingPt_notes = decomposes
| Solubility = Soluble
| pKa =2.28 (carboxyl), 9.21 (amino)<ref>{{Cite book |last1=Dawson |first1=Rex M. C. |title=Data for Biochemical Research |last2=Elliott |first2=Daphne C. |last3=Elliott |first3=William H. |last4=Jones |first4=K. M. |date=1959 |publisher=Clarendon Press |location=Oxford |name-list-style=vanc}}</ref>
  }}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = V03
| ATCCode_suffix = AB26
| ATC_Supplemental = {{ATCvet|A05|BA90}}, {{ATCvet|G04|BA90}}
}}
|Section7={{Chembox Hazards
| FlashPt = 
 }}
}}
'''Métionin''' (lambangna '''Met''' atawa '''M''')<ref>{{Cite web |url=http://www.chem.qmul.ac.uk/iupac/AminoAcid/AA1n2.html |title=Nomenclature and Symbolism for Amino Acids and Peptides |year=1983 |publisher=IUPAC-IUB Joint Commission on Biochemical Nomenclature |url-status=dead |archive-url=https://web.archive.org/web/20081009023202/http://www.chem.qmul.ac.uk/iupac/AminoAcid/AA1n2.html |archive-date=9 October 2008 |access-date=5 March 2018 }} {{Webarchive|url=https://web.archive.org/web/20081009023202/http://www.chem.qmul.ac.uk/iupac/AminoAcid/AA1n2.html |date=9 October 2008 }}</ref> ({{IPAc-en|m|ɪ|ˈ|θ|aɪ|ə|n|iː|n}})<ref>{{Cite web |url=https://en.oxforddictionaries.com/definition/methionine |title=Methionine |publisher=Oxford University Press }} {{Webarchive|url=https://web.archive.org/web/20180127083819/https://en.oxforddictionaries.com/definition/methionine |date=2018-01-27 }}</ref> nyaéta [[asam amino ésénsial]] pikeun manusa. Salaku prékursor asam amino [[sistéin]] jeung [[taurin]], sanyawa multiguna sarupaning [[SAM-e]], jeung antioksidan penting [[glutation]], métionin mancén peran penting dina métabolisme jeung kaséhatan rupa-rupa spésiés.

Métionin ogé penting dina [[angiogenesis]], tumuwuhna pembuluh getih. Supleméntasi métionin bisa natambaan anu karacunan tambaga.<ref>{{Cite web |url=http://www.webmd.com/vitamins-supplements/ingredientmono-42-methionine.aspx?activeingredientid=42& |title=Methionine |website=WebMD}}</ref> Sabalikna, asupan métionin anu kaleuleuwihi, donor [[gugus métil]] dina [[métilasi DNA]], tumali jeung tumuwuhna [[kangker]] dina sababaraha panalungtikan.<ref name="Cavuoto_2012">{{Cite journal |vauthors=Cavuoto P, Fenech MF |year=2012 |title=A review of methionine dependency and the role of methionine restriction in cancer growth control and life-span extension |journal=Cancer Treatment Reviews |volume=38 |issue=6 |pages=726–36 |doi=10.1016/j.ctrv.2012.01.004 |pmid=22342103}}</ref><ref name="Cellarier_2003">{{Cite journal |vauthors=Cellarier E, Durando X, Vasson MP, Farges MC, Demiden A, Maurizis JC, Madelmont JC, Chollet P |year=2003 |title=Methionine dependency and cancer treatment |journal=Cancer Treatment Reviews |volume=29 |issue=6 |pages=489–99 |doi=10.1016/S0305-7372(03)00118-X |pmid=14585259}}</ref> Métionin munggaran diisolasi taun 1921 ku [[John Howard Mueller]].<ref>{{Cite web |url=http://www.nasonline.org/publications/biographical-memoirs/memoir-pdfs/mueller-john.pdf |title=A Biographical Memoir of John Howard Mueller |date=1987 |publisher=National Academy of Sciences |location=Washington D.C. |vauthors=Pappenheimer AM}}</ref>

==Watek biokimia==
Métionin (lambangna '''Met''' atawa '''M'''; dikode ku kodon AUG) téh asam α-amino anu dipaké dina [[biosintésis]] [[protéin]]. Ieu ngandung [[gugus karboksil]] (dina wangun kurang proton −COO<sup>−</sup> dina kaayaan [[pH]] biologis), [[gugus amino]] (dina wangun leuwih proton −NH<sub>3</sub><sup>+</sup> dina kaayaan pH biologis) dina α-posisi ti gugus karboksil, sarta ranté gigir S-métil [[tioéter]], kagolongkeun kana asam amino [[polaritas kimia|nonpolar]] [[Sanyawa alipatik|alipatik]].

Dina [[gén]] inti [[eukariot]] jeung [[Archaea]], métionin nyandi pikeun [[kodon mitembeyan]], hartina nandaan ngamimitian [[daérah koding]] jeung asam amino munggaran anu diproduksi dina [[Péptida|polipéptida]] nalika [[Translasi (biologi)|translasi]] [[mRNA]].<ref>{{Cite journal |vauthors=Guedes RL, Prosdocimi F, Fernandes GR, Moura LK, Ribeiro HA, Ortega JM |date=December 2011 |title=Amino acids biosynthesis and nitrogen assimilation pathways: a great genomic deletion during eukaryotes evolution |journal=BMC Genomics |volume=12 Suppl 4 |pages=S2 |doi=10.1186/1471-2164-12-S4-S2 |pmc=3287585 |pmid=22369087}}</ref>

== Baca ogé ==
* [[Allantoin]]
* [[Formilmétionin]]
* [[Oksidasi métionin]]
* [[Karacunan parasétamol#Natambaan|Karacunan parasétamol]] 
* [[S-Métilsistéin]]

== Rujukan ==
{{Reflist|32em}}

== Tutumbu kaluar ==
* {{Cite journal | title = Methionine Content of Cereals and Legumes | first1 = M. N. | last1 = Rudra | first2 = L. M. | last2 = Chowdhury | name-list-style = vanc | journal = [[Nature (journal)|Nature]] | volume = 166 | date = 30 September 1950 | doi = 10.1038/166568a0 | pmid = 14780151 | issue = 568 | pages = 568 |bibcode = 1950Natur.166..568R | s2cid = 3026278 | doi-access = free }}

{{Asam amino protéinogenik}}
{{Antidot}}
{{Intermédiat métabolisme asam amino}}

[[Category:Asam amino protéinogenik]]
[[Category:Asam amino glukogenik]]
[[Category:Asam amino sulpur]]
[[Category:Tioéter]]
[[Category:Asam amino ésénsial]]