Témbongkeun sumber pikeun Sistéin

{{Short description|Asam amino}}
{{Distinguish|sitosin|sistin|sitisin|sitidin|Sistin}}
{{Redirect|Cys}}
{{Chembox
| Verifiedfields = changed
| Watchedfields  = changed
| verifiedrevid  = 443554430
| Name           = {{sm|l}}-Sistéin
| ImageFile_Ref  = {{chemboximage|correct|??}}
| ImageFile      = L-Cystein - L-Cysteine.svg
| ImageCaption   = [[Rumus rangka]] <small>L</small>-sistéin
| ImageFileL1    = Cysteine-from-xtal-3D-bs-17.png
| ImageCaptionL1 = [[Modél bal jeung stik]]
| ImageFileR1    = L-cysteine-from-xtal-Mercury-3D-sf.png
| ImageCaptionR1 = [[Modél ngeusi rohang]]
| IUPACName      = Cysteine
| OtherNames     = Asam 2-amino-3-sulphidrilpropanoat
| SystematicName = 
| Section1       = {{Chembox Identifiers
| IUPHAR_ligand = 4782
| Abbreviations = '''Cys''', '''C'''
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = K848JZ4886
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1 = A9U1687S1S
| UNII1_Comment = (hydrochloride)
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 54943
| InChI = 1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1
| InChIKey = XUJNEKJLAYXESH-REOHCLBHBU
| InChI1 = 1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)
| InChIKey1 = XUJNEKJLAYXESH-UHFFFAOYAC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XUJNEKJLAYXESH-UHFFFAOYSA-N
| CASNo = 52-90-4
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo2_Ref = {{cascite|correct|CAS}}
| CASNo2 = 52-89-1
| CASNo2_Comment = (hidroklorida) <!-- also verified at CAS Common Chemistry -->
| EC_number = 200-158-2
| PubChem = 5862
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 574
| ChemSpiderID_Comment = (Rasemat)
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 5653
| ChemSpiderID1_Comment = (<small>L</small>-form)
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00026
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15356
| SMILES = C([C@@H](C(=O)O)N)S
| SMILES1 = C([C@@H](C(=O)[O-])[NH3+])S
| SMILES1_Comment = [[Zwitterion]]
}}
| Section2       = {{Chembox Properties
| Properties_ref = <ref>{{RubberBible62nd|page=C-259}}.</ref>
| C=3 | H=7 | N=1 | O=2 | S=1
| Appearance = tipung atawa kristal bodas
| Density =
| MeltingPtC = 240
| MeltingPt_notes = decomposes
| SpecRotation = +9.4° (H<sub>2</sub>O, ''c'' = 1.3)
| Solubility = soluble
| SolubleOther = 1.5g/100g étanol 19 degC <ref>{{Cite book | url = https://books.google.com/books?id=xteiARU46SQC&pg=PA15 | title = Food Chemistry | isbn = 9783540699330 | last1 = Belitz | first1 = H.-D | last2 = Grosch | first2 = Werner | last3 = Schieberle | first3 = Peter | date = 2009-02-27 }}</ref>
  }}
| Section3       = 
| Section4       = 
| Section5       = 
| Section6       = 
}}

'''Sistéina''' atawa '''sistéin''' (lambang '''Cys''' atawa '''C''';<ref>{{IUPAC-IUB amino acids 1983}}</ref> {{IPAc-en|ˈ|s|ɪ|s|t|ɪ|iː|n}})<ref>{{cite web|url=https://en.oxforddictionaries.com/definition/cysteine|title=cysteine - Definition of cysteine in English by Oxford Dictionaries|website=Oxford Dictionaries - English|access-date=15 April 2018}} {{Webarchive|url=https://web.archive.org/web/20160925134245/https://en.oxforddictionaries.com/definition/cysteine |date=25 September 2016 }}</ref> nyaéta [[asam amino protéinogenik]] semiésénsial<ref name=microbial>{{cite web|title=The primary structure of proteins is the amino acid sequence|url=http://www.microbiologytext.com/index.php?module=Book&func=displayarticle&art_id=661|work=The Microbial World|publisher=University of Wisconsin-Madison Bacteriology Department|access-date=16 September 2012|archive-date=25 May 2013|archive-url=https://web.archive.org/web/20130525095344/http://www.microbiologytext.com/index.php?module=Book&func=displayarticle&art_id=661|url-status=dead}} {{Webarchive|url=https://web.archive.org/web/20130525095344/http://www.microbiologytext.com/index.php?module=Book&func=displayarticle&art_id=661 |date=25 May 2013 }}</ref> anu [[rumus kimia|rumusna]] HOOC-CH-(NH<sub>2</sub>)-CH<sub>2</sub>-SH. Ranté gigir [[tiol]] dina sistéin osok kapaké dina réaksi [[énzimatik]] salaku [[nukléopil]].

Nalika aya salaku résidu katalitik deprotonasi, kadang simbol '''Cyz''' dipaké.<ref>{{Cite web |title=python - How can I programmatically add Hydrogen to a PDB structure using BioPython? |url=https://bioinformatics.stackexchange.com/questions/17916/how-can-i-programmatically-add-hydrogen-to-a-pdb-structure-using-biopython |access-date=2022-05-12 |website=Bioinformatics Stack Exchange |language=en}}</ref><ref>{{Cite web |title=type of docking {{!}} RosettaCommons |url=https://www.rosettacommons.org/node/10906 |access-date=2022-05-12 |website=www.rosettacommons.org}}</ref> Wangun deprotonasi umumna bisa maké simbol '''Cym''' ogé.<ref name=":0">{{Cite web |title=Amber Workshop - Tutorial A1 - Section 1: Do some editing of the PDB file |url=https://ambermd.org/tutorials/advanced/tutorial1_orig/section1.htm |access-date=2022-06-02 |website=ambermd.org }} {{Webarchive|url=https://web.archive.org/web/20220522002234/https://ambermd.org/tutorials/advanced/tutorial1_orig/section1.htm |date=2022-05-22 }}</ref> Ieu tiol babari kaoksidasi jadi turunan [[beungkeut disulpida|disulpida]] [[sistin]], anu boga pancén struktural penting dina [[protéin]]. Dina ieu kasus, simbol '''Cyx''' kadang dipaké.<ref name=":0" /> Nalika dipaké aditip dahareun, [[nomer E]]-na E920.

Sistéin [[Kode genetik|dikode]] ku [[kodon]] UGU jeung UGC.

<!-- Storage -->
Sistéin jeung [[métionin]] anu ngandung walirang leuwih babari kaoksidasi batan asam amino lianna.<ref>{{cite journal |last1=Bin |first1=P |last2=Huang |first2=R |last3=Zhou |first3=X |title=Oxidation Resistance of the Sulfur Amino Acids: Methionine and Cysteine. |journal=BioMed research international |date=2017 |volume=2017 |pages=9584932 |doi=10.1155/2017/9584932 |pmid=29445748 |pmc=5763110}}</ref><ref name="BCLee">{{cite journal |vauthors=Lee BC, Dikiy A, Kim HY, Gladyshev VN | title=Functions and evolution of selenoprotein methionine sulfoxide reductases | journal=Biochimica et Biophysica Acta (BBA) - General Subjects | volume=1790 | issue=11 | year=2009 | pages=1471–1477  | pmid=19406207 | pmc=3062201 | doi=10.1016/j.bbagen.2009.04.014}}</ref>

==Baca ogé==
{{Commons category|Cysteine}}
* [[Métabolisme sistéin]]
* [[Sistinuria]]
* [[Réaksi Saville]]
* [[Réaksi Sullivan]]

==Rujukan==
{{Reflist|30em}}

==Bacaan salajengna==
* {{cite journal |vauthors=Nagano N, Ota M, Nishikawa K |title=Strong hydrophobic nature of cysteine residues in proteins |journal=FEBS Lett. |volume=458 |issue=1 |pages=69–71 |date=September 1999 |pmid=10518936 |doi=10.1016/S0014-5793(99)01122-9|s2cid=34980474 |doi-access=free }}

==Tutumbu kaluar==
* [http://gmd.mpimp-golm.mpg.de/Spectrums/90eac3d9-ee59-4f02-a245-631bde944b66.aspx Cysteine MS Spectrum]
* [http://www.iksi.org International Kidney Stone Institute] {{Webarchive|url=https://web.archive.org/web/20190513095547/http://www.iksi.org/ |date=2019-05-13 }}
* [http://www.chemie.fu-berlin.de/chemistry/bio/aminoacid/cystein_en.html http://www.chemie.fu-berlin.de/chemistry/bio/aminoacid/cystein en.html] {{Webarchive|url=https://web.archive.org/web/20161110090138/http://www.chemie.fu-berlin.de/chemistry/bio/aminoacid/cystein_en.html |date=2016-11-10 }}
* [https://web.archive.org/web/20080503021235/http://www.kolumbus.fi/justal/klami/ 952-10-3056-9 Interaction of alcohol and smoking in the pathogenesis of upper digestive tract cancers - possible chemoprevention with cysteine]
* [https://web.archive.org/web/20130521211422/http://cystinuriaclearinghouse.com/index.html Cystine Kidney Stones]
* [http://www.kashrut.com/articles/L_cysteine Kosher View of L-Cysteine]

{{Antidot}}
{{Asam amino protéinogenik}}
{{E number infobox 920-929}}
{{Intermédiat métabolisme amino amino}}

[[Category:Asam amino protéinogenik]]
[[Category:Asam amino glukogenik]]
[[Category:Asam amino walirang]]
[[Category:Tiol]]
[[Category:Aditip dahareun]]
[[Category:Aditip nomer-E]]